CymitQuimica logo

CAS 1187164-90-4

:

(2,3-Dimethylphenyl)(5-methyl-2-pyridinyl)methanone

Description:
(2,3-Dimethylphenyl)(5-methyl-2-pyridinyl)methanone, with the CAS number 1187164-90-4, is an organic compound characterized by its complex structure, which includes a phenyl group substituted with two methyl groups and a pyridine ring with a methyl substituent. This compound typically exhibits properties associated with ketones, such as a carbonyl functional group that contributes to its reactivity and potential for forming hydrogen bonds. The presence of both aromatic and heterocyclic components suggests that it may possess interesting electronic properties, potentially influencing its behavior in chemical reactions and interactions. Additionally, the methyl groups can affect the steric hindrance and solubility of the compound, which may be relevant in applications such as pharmaceuticals or agrochemicals. Its specific characteristics, including melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Overall, this compound represents a unique combination of structural features that could lead to diverse chemical behavior and applications.
Formula:C15H15NO
InChI:InChI=1S/C15H15NO/c1-10-7-8-14(16-9-10)15(17)13-6-4-5-11(2)12(13)3/h4-9H,1-3H3
InChI key:InChIKey=DIFDRTSCZJSXPC-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(C)C(C)=CC=C1)C2=CC=C(C)C=N2
Synonyms:
  • Methanone, (2,3-dimethylphenyl)(5-methyl-2-pyridinyl)-
  • (2,3-Dimethylphenyl)(5-methyl-2-pyridinyl)methanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.