CAS 1187164-99-3
:(2-Chlorophenyl)(6-chloro-3-pyridinyl)methanone
Description:
(2-Chlorophenyl)(6-chloro-3-pyridinyl)methanone, identified by its CAS number 1187164-99-3, is an organic compound characterized by its complex structure, which includes a chlorinated phenyl group and a pyridine moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the carbonyl group. The chlorinated groups can influence its electronic properties, potentially enhancing its reactivity in electrophilic substitution reactions. Additionally, the presence of the pyridine ring may impart basicity and influence solubility in various solvents. This compound may be of interest in medicinal chemistry and material science due to its potential biological activity and utility in synthesizing other chemical entities. Its specific applications and behavior would depend on further studies, including its interaction with biological systems or its role in chemical reactions. As with many chlorinated compounds, considerations regarding environmental impact and toxicity are also important in its handling and application.
Formula:C12H7Cl2NO
InChI:InChI=1S/C12H7Cl2NO/c13-10-4-2-1-3-9(10)12(16)8-5-6-11(14)15-7-8/h1-7H
InChI key:InChIKey=SQSYIAYULMJWAD-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(Cl)C=CC=C1)C=2C=CC(Cl)=NC2
Synonyms:- Methanone, (2-chlorophenyl)(6-chloro-3-pyridinyl)-
- (2-Chlorophenyl)(6-chloro-3-pyridinyl)methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.