CymitQuimica logo

CAS 1187165-00-9

:

(2,4-Dimethoxyphenyl)(6-methyl-3-pyridinyl)methanone

Description:
(2,4-Dimethoxyphenyl)(6-methyl-3-pyridinyl)methanone, identified by its CAS number 1187165-00-9, is an organic compound characterized by its complex structure, which includes a phenyl ring substituted with two methoxy groups and a pyridine ring with a methyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of functional groups. The methoxy groups can influence its solubility and polarity, while the pyridine moiety may contribute to its basicity and potential interactions in biological systems. The compound may also display interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its synthesis and characterization would involve standard organic chemistry techniques, including spectroscopy for structural confirmation. Overall, this compound's unique combination of functional groups suggests potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C15H15NO3
InChI:InChI=1S/C15H15NO3/c1-10-4-5-11(9-16-10)15(17)13-7-6-12(18-2)8-14(13)19-3/h4-9H,1-3H3
InChI key:InChIKey=UHSKPLSDMYXALI-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(OC)C=C(OC)C=C1)C=2C=CC(C)=NC2
Synonyms:
  • (2,4-Dimethoxyphenyl)(6-methyl-3-pyridinyl)methanone
  • Methanone, (2,4-dimethoxyphenyl)(6-methyl-3-pyridinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.