CAS 1187165-03-2

(2-Iodophenyl)(6-methoxy-2-pyridinyl)methanone

Description:

(2-Iodophenyl)(6-methoxy-2-pyridinyl)methanone is an organic compound characterized by its complex structure, which includes a phenyl group substituted with iodine and a pyridine ring that features a methoxy group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to the presence of the pyridine moiety. The iodine atom can influence the compound's reactivity and stability, often enhancing its lipophilicity and potentially affecting its interaction with biological targets. The methoxy group contributes to the compound's electronic properties, possibly affecting its solubility and reactivity. As a result, this compound may be of interest in medicinal chemistry and drug development, particularly in the design of new pharmaceuticals. Its specific applications and behavior would depend on further studies, including its synthesis, reactivity, and biological activity. Overall, (2-Iodophenyl)(6-methoxy-2-pyridinyl)methanone represents a versatile structure with potential implications in various chemical and biological contexts.

Formula: C₁₃H₁₀INO₂

InChI: InChI=1S/C13H10INO2/c1-17-12-8-4-7-11(15-12)13(16)9-5-2-3-6-10(9)14/h2-8H,1H3

InChI key: InChIKey=WKALQWIGCXPKOR-UHFFFAOYSA-N

SMILES: C(=O)(C=1N=C(OC)C=CC1)C2=C(I)C=CC=C2

Synonyms:

• (2-Iodophenyl)(6-methoxy-2-pyridinyl)methanone
• Methanone, (2-iodophenyl)(6-methoxy-2-pyridinyl)-