CymitQuimica logo

CAS 1187165-06-5

:

(3-Chlorophenyl)(4-methyl-2-pyridinyl)methanone

Description:
(3-Chlorophenyl)(4-methyl-2-pyridinyl)methanone, identified by its CAS number 1187165-06-5, is an organic compound characterized by its unique molecular structure, which includes a chlorophenyl group and a pyridinyl moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential reactivity and stability. The presence of the chlorophenyl group may impart certain electronic effects, influencing its chemical behavior, such as reactivity in electrophilic substitution reactions. The pyridinyl component can enhance solubility in polar solvents and may participate in hydrogen bonding due to the nitrogen atom in the ring. This compound may also exhibit biological activity, making it of interest in pharmaceutical research. Its synthesis and applications could be relevant in various fields, including medicinal chemistry and materials science. As with many organic compounds, safety data and handling precautions should be considered, particularly regarding its potential toxicity and environmental impact.
Formula:C13H10ClNO
InChI:InChI=1S/C13H10ClNO/c1-9-5-6-15-12(7-9)13(16)10-3-2-4-11(14)8-10/h2-8H,1H3
InChI key:InChIKey=ZKZUQVQOQXNFJZ-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(Cl)=CC=C1)C2=CC(C)=CC=N2
Synonyms:
  • (3-Chlorophenyl)(4-methyl-2-pyridinyl)methanone
  • Methanone, (3-chlorophenyl)(4-methyl-2-pyridinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.