CAS 1187165-08-7: (2-Methyl-4-pyridinyl)[4-(trifluoromethyl)phenyl]methanone

Description:The chemical substance known as (2-Methyl-4-pyridinyl)[4-(trifluoromethyl)phenyl]methanone, with the CAS number 1187165-08-7, is characterized by its complex molecular structure, which includes a pyridine ring and a trifluoromethyl-substituted phenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of functional groups. The trifluoromethyl group is known to enhance lipophilicity and can influence the compound's biological activity, making it of interest in pharmaceutical research. Additionally, the presence of the methyl group on the pyridine ring can affect the electronic properties and steric hindrance of the molecule. This compound may be utilized in various applications, including medicinal chemistry and material science, due to its unique structural features. Its solubility, melting point, and other physical properties would depend on the specific conditions and solvent used. Overall, this substance represents a class of compounds that may exhibit significant biological and chemical activity.

Formula:C₁₄H₁₀F₃NO

InChI:InChI=1S/C14H10F3NO/c1-9-8-11(6-7-18-9)13(19)10-2-4-12(5-3-10)14(15,16)17/h2-8H,1H3

InChI key:InChIKey=QEHAPJJOHIYHBN-UHFFFAOYSA-N

SMILES:O=C(C1=CC=C(C=C1)C(F)(F)F)C=2C=CN=C(C2)C

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	2-Methyl-4-(4-trifluoromethylbenzoyl)pyridine REF: 10-F203466CAS: 1187165-08-7	97.0%	- - -	Discontinued product
	2-Methyl-4-(4-trifluoromethylbenzoyl)pyridine REF: 3D-MXB16508CAS: 1187165-08-7	Min. 95%	- - -	Discontinued product