CAS 1187165-17-8

(4-Methyl-2-pyridinyl)[2-(trifluoromethyl)phenyl]methanone

Description:

(4-Methyl-2-pyridinyl)[2-(trifluoromethyl)phenyl]methanone, identified by its CAS number 1187165-17-8, is a chemical compound characterized by its unique structural features. It contains a pyridine ring substituted with a methyl group at the 4-position and a ketone functional group linked to a phenyl ring that has a trifluoromethyl group at the 2-position. This compound exhibits properties typical of both aromatic and heterocyclic compounds, contributing to its potential reactivity and stability. The presence of the trifluoromethyl group enhances lipophilicity and can influence the compound's biological activity, making it of interest in medicinal chemistry. Additionally, the pyridine moiety may participate in various chemical interactions, including hydrogen bonding and coordination with metal ions. Overall, this compound's unique combination of functional groups and structural characteristics may render it useful in various applications, including pharmaceuticals and agrochemicals, although specific applications would depend on further research and development.

Formula: C₁₄H₁₀F₃NO

InChI: InChI=1S/C14H10F3NO/c1-9-6-7-18-12(8-9)13(19)10-4-2-3-5-11(10)14(15,16)17/h2-8H,1H3

InChI key: InChIKey=AOFQDCCEBTVAMO-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(C(F)(F)F)C=CC=C1)C2=CC(C)=CC=N2

Synonyms:

• Methanone, (4-methyl-2-pyridinyl)[2-(trifluoromethyl)phenyl]-
• (4-Methyl-2-pyridinyl)[2-(trifluoromethyl)phenyl]methanone