CAS 1187165-24-7
:(2-Methylphenyl)(3-methyl-2-pyridinyl)methanone
Description:
(2-Methylphenyl)(3-methyl-2-pyridinyl)methanone, identified by its CAS number 1187165-24-7, is an organic compound characterized by its complex structure, which includes a ketone functional group. This compound features a methyl-substituted phenyl ring and a pyridine ring with a methyl group at the 3-position, contributing to its unique chemical properties. The presence of both aromatic and heterocyclic components suggests potential for diverse reactivity, including electrophilic aromatic substitution and nucleophilic attacks at the carbonyl carbon. Its molecular structure may impart specific physical properties such as solubility in organic solvents and potential for crystallization. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. However, detailed information regarding its toxicity, stability, and specific applications would require further investigation through experimental studies and literature review. Overall, this compound represents a fascinating example of a ketone with both aromatic and heteroaromatic characteristics, which could be explored for various chemical applications.
Formula:C14H13NO
InChI:InChI=1S/C14H13NO/c1-10-6-3-4-8-12(10)14(16)13-11(2)7-5-9-15-13/h3-9H,1-2H3
InChI key:InChIKey=SLDJUGFYTZKKGA-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(C)C=CC=C1)C2=C(C)C=CC=N2
Synonyms:- Methanone, (2-methylphenyl)(3-methyl-2-pyridinyl)-
- (2-Methylphenyl)(3-methyl-2-pyridinyl)methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.