CAS 1187165-33-8

(3-Methyl-2-pyridinyl)[4-(trifluoromethyl)phenyl]methanone

Description:

(3-Methyl-2-pyridinyl)[4-(trifluoromethyl)phenyl]methanone, with the CAS number 1187165-33-8, is an organic compound characterized by its complex structure, which includes a pyridine ring and a phenyl group substituted with a trifluoromethyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the carbonyl functional group. The trifluoromethyl group enhances lipophilicity and can influence the compound's biological activity, making it of interest in pharmaceutical research. The methyl group on the pyridine ring may also affect its electronic properties and steric hindrance. Overall, this compound is likely to be a solid at room temperature, with potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Its specific reactivity and interactions would depend on the functional groups present and the overall molecular conformation.

Formula: C₁₄H₁₀F₃NO

InChI: InChI=1S/C14H10F3NO/c1-9-3-2-8-18-12(9)13(19)10-4-6-11(7-5-10)14(15,16)17/h2-8H,1H3

InChI key: InChIKey=XAEJBIVJYGXENH-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(C(F)(F)F)C=C1)C2=C(C)C=CC=N2

Synonyms:

• (3-Methyl-2-pyridinyl)[4-(trifluoromethyl)phenyl]methanone
• Methanone, (3-methyl-2-pyridinyl)[4-(trifluoromethyl)phenyl]-

3-Methyl-2-(4-trifluoromethylbenzoyl)pyridine

CAS: 1187165-33-8

Formula: C₁₄H₁₀F₃NO

Purity: 97.0%

Molecular weight: 265.235

Ref: 10-F202986