CAS 1187165-35-0
:(6-Methoxy-2-pyridinyl)(2,3,4,5,6-pentafluorophenyl)methanone
Description:
(6-Methoxy-2-pyridinyl)(2,3,4,5,6-pentafluorophenyl)methanone is a chemical compound characterized by its complex structure, which includes a pyridine ring and a highly fluorinated phenyl group. The presence of the methoxy group on the pyridine ring enhances its solubility and reactivity, while the pentafluorophenyl moiety significantly increases the compound's lipophilicity and stability due to the strong electronegative influence of the fluorine atoms. This compound is likely to exhibit interesting electronic properties and may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Its unique structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. Additionally, the presence of multiple fluorine atoms can impart unique biological activities and influence the compound's interaction with biological targets. Overall, this compound represents a fascinating example of how structural modifications can lead to diverse chemical behaviors and potential applications in various fields.
Formula:C13H6F5NO2
InChI:InChI=1S/C13H6F5NO2/c1-21-6-4-2-3-5(19-6)13(20)7-8(14)10(16)12(18)11(17)9(7)15/h2-4H,1H3
InChI key:InChIKey=WAMHCHYPQCDMMU-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(F)C(F)=C(F)C(F)=C1F)C=2N=C(OC)C=CC2
Synonyms:- Methanone, (6-methoxy-2-pyridinyl)(2,3,4,5,6-pentafluorophenyl)-
- (6-Methoxy-2-pyridinyl)(2,3,4,5,6-pentafluorophenyl)methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.