CAS 1187165-41-8

(2,3-Dimethoxyphenyl)-3-pyridinylmethanone

Description:

(2,3-Dimethoxyphenyl)-3-pyridinylmethanone, identified by its CAS number 1187165-41-8, is an organic compound characterized by its complex structure, which includes a phenyl ring substituted with two methoxy groups and a pyridine moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of functional groups. The methoxy groups can influence its solubility and polarity, making it more soluble in organic solvents. Additionally, the pyridine ring contributes to the compound's basicity and potential for coordination with metal ions. Its unique structure may impart biological activity, making it of interest in medicinal chemistry and drug development. The compound's synthesis and characterization would involve standard organic chemistry techniques, including spectroscopic methods for confirmation of its structure. Overall, (2,3-Dimethoxyphenyl)-3-pyridinylmethanone represents a class of compounds that may have applications in pharmaceuticals or as intermediates in organic synthesis.

Formula: C₁₄H₁₃NO₃

InChI: InChI=1S/C14H13NO3/c1-17-12-7-3-6-11(14(12)18-2)13(16)10-5-4-8-15-9-10/h3-9H,1-2H3

InChI key: InChIKey=YPCWMPZCJAATLH-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(OC)C(OC)=CC=C1)C=2C=CC=NC2

Synonyms:

• Methanone, (2,3-dimethoxyphenyl)-3-pyridinyl-
• (2,3-Dimethoxyphenyl)-3-pyridinylmethanone