CAS 1187165-45-2
:(2-Iodophenyl)(3-methyl-2-pyridinyl)methanone
Description:
(2-Iodophenyl)(3-methyl-2-pyridinyl)methanone, identified by its CAS number 1187165-45-2, is an organic compound characterized by its complex structure, which includes a phenyl ring substituted with an iodine atom and a pyridine ring with a methyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the carbonyl group (ketone). The iodine substituent can influence the compound's reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the presence of the pyridine moiety may impart basicity and influence solubility in polar solvents. The compound's unique structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where the interplay of the aromatic and heterocyclic components can be crucial for biological activity. Overall, (2-Iodophenyl)(3-methyl-2-pyridinyl)methanone represents a versatile chemical entity with interesting properties for further exploration in research and application.
Formula:C13H10INO
InChI:InChI=1S/C13H10INO/c1-9-5-4-8-15-12(9)13(16)10-6-2-3-7-11(10)14/h2-8H,1H3
InChI key:InChIKey=LUECUPAUPUABEK-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(I)C=CC=C1)C2=C(C)C=CC=N2
Synonyms:- Methanone, (2-iodophenyl)(3-methyl-2-pyridinyl)-
- (2-Iodophenyl)(3-methyl-2-pyridinyl)methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.