CAS 1187165-52-1

(2,4-Dimethoxyphenyl)(2-methyl-4-pyridinyl)methanone

Description:

(2,4-Dimethoxyphenyl)(2-methyl-4-pyridinyl)methanone, identified by its CAS number 1187165-52-1, is an organic compound characterized by its complex structure, which includes a phenyl group substituted with two methoxy groups and a pyridine ring with a methyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of functional groups. The methoxy groups can influence its solubility and polarity, while the pyridine moiety may contribute to its basicity and potential interactions in biological systems. The compound may be of interest in medicinal chemistry, particularly for its potential pharmacological activities, as derivatives of similar structures have been explored for various therapeutic applications. Its synthesis and characterization would involve standard organic chemistry techniques, including spectroscopic methods for confirmation of structure. Overall, this compound represents a class of molecules that could have significant implications in drug development and materials science.

Formula: C₁₅H₁₅NO₃

InChI: InChI=1S/C15H15NO3/c1-10-8-11(6-7-16-10)15(17)13-5-4-12(18-2)9-14(13)19-3/h4-9H,1-3H3

InChI key: InChIKey=ZHMIWUIXGQANDY-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(OC)C=C(OC)C=C1)C=2C=C(C)N=CC2

Synonyms:

• (2,4-Dimethoxyphenyl)(2-methyl-4-pyridinyl)methanone
• Methanone, (2,4-dimethoxyphenyl)(2-methyl-4-pyridinyl)-