CAS 1187165-73-6

(4-Iodophenyl)-4-isoquinolinylmethanone

Description:

(4-Iodophenyl)-4-isoquinolinylmethanone is a chemical compound characterized by its unique structure, which includes a phenyl ring substituted with an iodine atom and an isoquinoline moiety. This compound typically exhibits properties associated with both aromatic systems, such as stability and potential for π-π stacking interactions. The presence of the iodine atom can influence its reactivity and solubility, often enhancing its lipophilicity. The methanone functional group contributes to its potential as a ketone, which may participate in various chemical reactions, including nucleophilic attacks. This compound may also exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its specific applications and interactions would depend on further studies, including its synthesis, reactivity under different conditions, and biological assays. Overall, (4-Iodophenyl)-4-isoquinolinylmethanone represents a versatile structure with potential implications in both synthetic and pharmaceutical chemistry.

Formula: C₁₆H₁₀INO

InChI: InChI=1S/C16H10INO/c17-13-7-5-11(6-8-13)16(19)15-10-18-9-12-3-1-2-4-14(12)15/h1-10H

InChI key: InChIKey=MSJZIUCRFDVOEX-UHFFFAOYSA-N

SMILES: C(=O)(C=1C2=C(C=NC1)C=CC=C2)C3=CC=C(I)C=C3

Synonyms:

• (4-Iodophenyl)-4-isoquinolinylmethanone
• Methanone, (4-iodophenyl)-4-isoquinolinyl-