CymitQuimica logo

CAS 1187165-75-8

:

[4-(1-Methylethoxy)phenyl](6-methyl-2-pyridinyl)methanone

Description:
The chemical substance known as [4-(1-Methylethoxy)phenyl](6-methyl-2-pyridinyl)methanone, with the CAS number 1187165-75-8, is an organic compound characterized by its complex structure that includes a phenyl group substituted with a methylethoxy group and a pyridinyl moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, which may influence its reactivity and interactions. It is likely to be a solid at room temperature, with potential applications in pharmaceuticals or agrochemicals, given the presence of functional groups that can participate in various chemical reactions. The presence of the methanone functional group suggests it may engage in nucleophilic addition reactions, while the pyridine ring can contribute to basicity and coordination chemistry. Additionally, the compound's solubility, stability, and specific reactivity would depend on its molecular interactions, including hydrogen bonding and π-π stacking due to the aromatic systems. Overall, this compound represents a class of molecules that may have significant biological or chemical activity.
Formula:C16H17NO2
InChI:InChI=1S/C16H17NO2/c1-11(2)19-14-9-7-13(8-10-14)16(18)15-6-4-5-12(3)17-15/h4-11H,1-3H3
InChI key:InChIKey=MHWCITZGUBVGEQ-UHFFFAOYSA-N
SMILES:C(=O)(C=1N=C(C)C=CC1)C2=CC=C(OC(C)C)C=C2
Synonyms:
  • [4-(1-Methylethoxy)phenyl](6-methyl-2-pyridinyl)methanone
  • Methanone, [4-(1-methylethoxy)phenyl](6-methyl-2-pyridinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.