CAS 1187165-85-0

(6-Chloro-3-pyridinyl)(2-iodophenyl)methanone

Description:

(6-Chloro-3-pyridinyl)(2-iodophenyl)methanone is an organic compound characterized by its complex structure, which includes a pyridine ring and a phenyl group substituted with iodine. The presence of the chloro and iodo substituents indicates that this compound may exhibit unique reactivity and properties, such as increased lipophilicity and potential for halogen bonding. The methanone functional group suggests that it may participate in various chemical reactions, including nucleophilic attacks and condensation reactions. This compound may be of interest in medicinal chemistry due to its potential biological activity, as halogenated compounds often exhibit enhanced pharmacological properties. Additionally, the presence of the pyridine ring can contribute to the compound's ability to interact with biological targets, making it a candidate for further research in drug development. Its specific applications and behavior in chemical reactions would depend on the context of its use and the conditions under which it is studied.

Formula: C₁₂H₇ClINO

InChI: InChI=1S/C12H7ClINO/c13-11-6-5-8(7-15-11)12(16)9-3-1-2-4-10(9)14/h1-7H

InChI key: InChIKey=SPBDULYNMUQTTQ-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(I)C=CC=C1)C=2C=CC(Cl)=NC2

Synonyms:

• (6-Chloro-3-pyridinyl)(2-iodophenyl)methanone
• Methanone, (6-chloro-3-pyridinyl)(2-iodophenyl)-