CAS 1187165-94-1

(6-Methoxy-2-pyridinyl)[2-(trifluoromethyl)phenyl]methanone

Description:

(6-Methoxy-2-pyridinyl)[2-(trifluoromethyl)phenyl]methanone, identified by its CAS number 1187165-94-1, is a chemical compound characterized by its complex structure, which includes a pyridine ring and a trifluoromethyl-substituted phenyl group. The presence of the methoxy group on the pyridine ring enhances its electron-donating properties, potentially influencing its reactivity and solubility in various solvents. The trifluoromethyl group is known for imparting unique electronic and steric properties, often enhancing the lipophilicity of the compound. This compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular structure suggests potential interactions with biological targets, which could be explored in drug discovery. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and industrial applications. Overall, this compound represents a class of organic molecules with diverse applications in chemical research and development.

Formula: C₁₄H₁₀F₃NO₂

InChI: InChI=1S/C14H10F3NO2/c1-20-12-8-4-7-11(18-12)13(19)9-5-2-3-6-10(9)14(15,16)17/h2-8H,1H3

InChI key: InChIKey=RQZRCSPAXKCVKE-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(C(F)(F)F)C=CC=C1)C=2N=C(OC)C=CC2

Synonyms:

• Methanone, (6-methoxy-2-pyridinyl)[2-(trifluoromethyl)phenyl]-
• (6-Methoxy-2-pyridinyl)[2-(trifluoromethyl)phenyl]methanone