CAS 1187165-98-5

4-[(6-Methyl-2-pyridinyl)carbonyl]benzonitrile

Description:

4-[(6-Methyl-2-pyridinyl)carbonyl]benzonitrile, identified by its CAS number 1187165-98-5, is an organic compound characterized by its complex structure, which includes a benzonitrile moiety and a pyridine ring with a methyl group. This compound typically exhibits properties common to aromatic nitriles, such as high stability and a tendency to participate in electrophilic aromatic substitution reactions. The presence of the pyridine ring introduces basicity and potential for coordination with metal ions, making it of interest in coordination chemistry. Additionally, the carbonyl group enhances its reactivity, allowing it to engage in various chemical transformations, including nucleophilic attacks. The compound may also display specific solubility characteristics, often being soluble in organic solvents while having limited solubility in water. Its unique structure suggests potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis, particularly in the development of biologically active molecules. Further studies would be necessary to explore its full range of chemical behavior and potential applications.

Formula: C₁₄H₁₀N₂O

InChI: InChI=1S/C14H10N2O/c1-10-3-2-4-13(16-10)14(17)12-7-5-11(9-15)6-8-12/h2-8H,1H3

InChI key: InChIKey=KSRPGDSAKYTEQC-UHFFFAOYSA-N

SMILES: C(=O)(C=1N=C(C)C=CC1)C2=CC=C(C#N)C=C2

Synonyms:

• 4-[(6-Methyl-2-pyridinyl)carbonyl]benzonitrile
• 2-(4-Cyanobenzoyl)-6-methylpyridine
• Benzonitrile, 4-[(6-methyl-2-pyridinyl)carbonyl]-

2-(4-Cyanobenzoyl)-6-methylpyridine

CAS: 1187165-98-5

Formula: C₁₄H₁₀N₂O

Purity: 97.0%

Molecular weight: 222.247

Ref: 10-F202795