CymitQuimica logo

CAS 1187166-09-1

:

(3-Phenoxyphenyl)-3-quinolinylmethanone

Description:
(3-Phenoxyphenyl)-3-quinolinylmethanone, identified by its CAS number 1187166-09-1, is a chemical compound characterized by its complex structure, which includes a quinoline moiety and a phenoxyphenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential biological activity. Its molecular structure suggests it may engage in π-π stacking interactions due to the presence of multiple aromatic rings, which can influence its solubility and reactivity. Additionally, the presence of the quinoline ring may impart specific pharmacological properties, making it of interest in medicinal chemistry. The compound may also exhibit fluorescence, a characteristic often associated with quinoline derivatives, which can be useful in various applications, including as a fluorescent probe in biological studies. Overall, (3-Phenoxyphenyl)-3-quinolinylmethanone represents a class of compounds that may have significant implications in research and development, particularly in the fields of pharmaceuticals and materials science.
Formula:C22H15NO2
InChI:InChI=1S/C22H15NO2/c24-22(18-13-16-7-4-5-12-21(16)23-15-18)17-8-6-11-20(14-17)25-19-9-2-1-3-10-19/h1-15H
InChI key:InChIKey=RPTOUYCHUZGVJX-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC2=C(N=C1)C=CC=C2)C3=CC(OC4=CC=CC=C4)=CC=C3
Synonyms:
  • Methanone, (3-phenoxyphenyl)-3-quinolinyl-
  • (3-Phenoxyphenyl)-3-quinolinylmethanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.