CAS 1187166-13-7

(2,6-Dimethoxyphenyl)(3-methyl-2-pyridinyl)methanone

Description:

(2,6-Dimethoxyphenyl)(3-methyl-2-pyridinyl)methanone, identified by its CAS number 1187166-13-7, is an organic compound characterized by its complex structure, which includes a phenyl group substituted with two methoxy groups and a pyridine ring with a methyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of functional groups. The methoxy groups can influence its solubility and polarity, making it more soluble in organic solvents. Additionally, the presence of the pyridine ring may impart basicity and contribute to the compound's biological activity, as many pyridine derivatives are known for their pharmacological properties. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. Its synthesis and reactivity can be influenced by the electronic effects of the substituents, making it a subject of interest in organic synthesis and material science.

Formula: C₁₅H₁₅NO₃

InChI: InChI=1S/C15H15NO3/c1-10-6-5-9-16-14(10)15(17)13-11(18-2)7-4-8-12(13)19-3/h4-9H,1-3H3

InChI key: InChIKey=JBWUQBBFCSGCEZ-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(OC)C=CC=C1OC)C2=C(C)C=CC=N2

Synonyms:

• Methanone, (2,6-dimethoxyphenyl)(3-methyl-2-pyridinyl)-
• (2,6-Dimethoxyphenyl)(3-methyl-2-pyridinyl)methanone