CAS 1187166-21-7: (2-Methylphenyl)(5-methyl-2-pyridinyl)methanone

Description:The chemical substance known as (2-Methylphenyl)(5-methyl-2-pyridinyl)methanone, with the CAS number 1187166-21-7, is an organic compound characterized by its complex structure, which includes both aromatic and heterocyclic components. It features a ketone functional group, indicated by the presence of the carbonyl (C=O) moiety, which is bonded to a 2-methylphenyl group and a 5-methyl-2-pyridinyl group. This compound is likely to exhibit properties typical of ketones, such as being a polar molecule due to the carbonyl group, which can engage in hydrogen bonding. The presence of the aromatic rings contributes to its stability and may influence its reactivity and solubility in various solvents. Additionally, the methyl substituents on both the phenyl and pyridine rings can affect the electronic properties and steric hindrance, potentially impacting its biological activity and interactions with other molecules. Overall, this compound may have applications in pharmaceuticals or materials science, although specific uses would depend on further research into its properties and behavior.

Formula:C₁₄H₁₃NO

InChI:InChI=1S/C14H13NO/c1-10-7-8-13(15-9-10)14(16)12-6-4-3-5-11(12)2/h3-9H,1-2H3

InChI key:InChIKey=TUWQEGKNSBUINQ-UHFFFAOYSA-N

SMILES:O=C(C1=NC=C(C=C1)C)C=2C=CC=CC2C

Synonyms:
(2-Methylphenyl)(5-methyl-2-pyridinyl)methanone
Methanone, (2-methylphenyl)(5-methyl-2-pyridinyl)-

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	2-(2-Methylbenzoyl)-5-methylpyridine REF: 10-F202845CAS: 1187166-21-7	97.0%	- - -	Discontinued product
	2-(2-Methylbenzoyl)-5-methylpyridine REF: 3D-MXB16621CAS: 1187166-21-7	Min. 95%	- - -	Discontinued product