CAS 1187166-32-0
:(2,3-Difluorophenyl)-3-quinolinylmethanone
Description:
(2,3-Difluorophenyl)-3-quinolinylmethanone is a chemical compound characterized by its unique structure, which includes a quinoline moiety and a difluorophenyl group. This compound typically exhibits properties associated with both aromatic systems, such as stability and potential for π-π stacking interactions. The presence of fluorine atoms enhances its lipophilicity and can influence its reactivity and biological activity, making it of interest in medicinal chemistry. The quinoline structure often contributes to its potential as a pharmacophore, with applications in various therapeutic areas. Additionally, the compound may exhibit specific spectral characteristics, such as UV-Vis absorbance and fluorescence properties, which can be utilized in analytical chemistry for detection and quantification. Its synthesis may involve standard organic reactions, including halogenation and carbonyl formation. Overall, (2,3-Difluorophenyl)-3-quinolinylmethanone represents a class of compounds that can be explored for their chemical reactivity and potential applications in drug development and materials science.
Formula:C16H9F2NO
InChI:InChI=1S/C16H9F2NO/c17-13-6-3-5-12(15(13)18)16(20)11-8-10-4-1-2-7-14(10)19-9-11/h1-9H
InChI key:InChIKey=ZEINMPSRVWTHPS-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC2=C(N=C1)C=CC=C2)C3=C(F)C(F)=CC=C3
Synonyms:- (2,3-Difluorophenyl)-3-quinolinylmethanone
- Methanone, (2,3-difluorophenyl)-3-quinolinyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.