CAS 1187166-38-6

(6-Methoxy-2-pyridinyl)[4-(1-methylethoxy)phenyl]methanone

Description:

(6-Methoxy-2-pyridinyl)[4-(1-methylethoxy)phenyl]methanone, identified by its CAS number 1187166-38-6, is a synthetic organic compound characterized by its complex molecular structure, which includes a pyridine ring and a ketone functional group. The presence of the methoxy group enhances its solubility and reactivity, while the ethoxy substituent contributes to its steric properties. This compound is typically studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological targets. Its molecular characteristics suggest it may exhibit specific biological activities, although detailed studies would be necessary to elucidate its pharmacological profile. The compound's stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature, making it important to consider these conditions in experimental settings. Overall, (6-Methoxy-2-pyridinyl)[4-(1-methylethoxy)phenyl]methanone represents a class of compounds that may hold promise in drug discovery and development.

Formula: C₁₆H₁₇NO₃

InChI: InChI=1S/C16H17NO3/c1-11(2)20-13-9-7-12(8-10-13)16(18)14-5-4-6-15(17-14)19-3/h4-11H,1-3H3

InChI key: InChIKey=HYSUYCYAZJYUJS-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(OC(C)C)C=C1)C=2N=C(OC)C=CC2

Synonyms:

• Methanone, (6-methoxy-2-pyridinyl)[4-(1-methylethoxy)phenyl]-
• (6-Methoxy-2-pyridinyl)[4-(1-methylethoxy)phenyl]methanone

2-(4-Isopropoxybenzoyl)-6-methoxypyridine

CAS: 1187166-38-6

Formula: C₁₆H₁₇NO₃

Purity: 97.0%

Molecular weight: 271.316

Ref: 10-F203075