CAS 1187166-48-8

(2,3-Difluorophenyl)(6-methoxy-2-pyridinyl)methanone

Description:

(2,3-Difluorophenyl)(6-methoxy-2-pyridinyl)methanone is an organic compound characterized by its complex structure, which includes a difluorophenyl group and a methoxy-substituted pyridine moiety. This compound features a ketone functional group, which contributes to its reactivity and potential applications in various chemical reactions. The presence of fluorine atoms in the difluorophenyl group enhances the compound's electronic properties, potentially influencing its biological activity and solubility. The methoxy group on the pyridine ring can also affect the compound's polarity and interaction with biological targets. Overall, this compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. Its specific characteristics, such as melting point, boiling point, and solubility, would typically be determined through experimental methods and could vary based on the conditions under which they are measured.

Formula: C₁₃H₉F₂NO₂

InChI: InChI=1S/C13H9F2NO2/c1-18-11-7-3-6-10(16-11)13(17)8-4-2-5-9(14)12(8)15/h2-7H,1H3

InChI key: InChIKey=OFWIHLDRFFWROX-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(F)C(F)=CC=C1)C=2N=C(OC)C=CC2

Synonyms:

• (2,3-Difluorophenyl)(6-methoxy-2-pyridinyl)methanone
• Methanone, (2,3-difluorophenyl)(6-methoxy-2-pyridinyl)-