CymitQuimica logo

CAS 1187166-51-3

:

(4-Hexylphenyl)(5-methyl-2-pyridinyl)methanone

Description:
(4-Hexylphenyl)(5-methyl-2-pyridinyl)methanone, identified by its CAS number 1187166-51-3, is an organic compound characterized by its complex structure, which includes a ketone functional group and aromatic rings. The presence of a hexyl group contributes to its hydrophobic properties, while the pyridine ring introduces basicity and potential for coordination with metal ions. This compound may exhibit interesting photophysical properties due to the conjugation between the aromatic systems, making it potentially useful in applications such as organic electronics or as a fluorescent probe. Its molecular structure suggests it could participate in various chemical reactions, including nucleophilic substitutions or electrophilic aromatic substitutions, depending on the reaction conditions. Additionally, the compound's solubility and stability can be influenced by the length of the alkyl chain and the nature of the substituents on the aromatic rings. Overall, (4-Hexylphenyl)(5-methyl-2-pyridinyl)methanone represents a versatile compound with potential applications in materials science and organic synthesis.
Formula:C19H23NO
InChI:InChI=1S/C19H23NO/c1-3-4-5-6-7-16-9-11-17(12-10-16)19(21)18-13-8-15(2)14-20-18/h8-14H,3-7H2,1-2H3
InChI key:InChIKey=SSCZBASDSLDJRP-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC=C(CCCCCC)C=C1)C2=CC=C(C)C=N2
Synonyms:
  • Methanone, (4-hexylphenyl)(5-methyl-2-pyridinyl)-
  • (4-Hexylphenyl)(5-methyl-2-pyridinyl)methanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.