CymitQuimica logo

CAS 1187166-53-5

:

(4-Ethoxyphenyl)-4-isoquinolinylmethanone

Description:
(4-Ethoxyphenyl)-4-isoquinolinylmethanone, identified by its CAS number 1187166-53-5, is a chemical compound that features a complex structure comprising an ethoxy-substituted phenyl group and an isoquinoline moiety. This compound is characterized by its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its unique structural properties. The presence of the ethoxy group enhances its solubility and may influence its biological activity. The isoquinoline structure is known for its role in various biological activities, including antitumor and antimicrobial properties. Additionally, the methanone functional group contributes to the compound's reactivity and stability. Overall, this compound's characteristics suggest it may serve as a valuable scaffold for further chemical modifications aimed at optimizing its therapeutic efficacy. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would need to be determined experimentally for specific applications.
Formula:C18H15NO2
InChI:InChI=1S/C18H15NO2/c1-2-21-15-9-7-13(8-10-15)18(20)17-12-19-11-14-5-3-4-6-16(14)17/h3-12H,2H2,1H3
InChI key:InChIKey=XGKNADGEQZXDPJ-UHFFFAOYSA-N
SMILES:C(=O)(C=1C2=C(C=NC1)C=CC=C2)C3=CC=C(OCC)C=C3
Synonyms:
  • Methanone, (4-ethoxyphenyl)-4-isoquinolinyl-
  • (4-Ethoxyphenyl)-4-isoquinolinylmethanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.