CAS 1187166-55-7

(5-Methyl-2-pyridinyl)[4-(pentyloxy)phenyl]methanone

Description:

(5-Methyl-2-pyridinyl)[4-(pentyloxy)phenyl]methanone, identified by its CAS number 1187166-55-7, is an organic compound characterized by its complex structure, which includes a pyridine ring and a phenyl group substituted with a pentyloxy chain. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential for various chemical reactions. The presence of the methanone functional group suggests it may participate in reactions typical of ketones, including nucleophilic addition and condensation reactions. Additionally, the pentyloxy substituent can influence its solubility and reactivity, potentially enhancing its lipophilicity. Such compounds may find applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to their ability to interact with biological targets. The specific characteristics, such as melting point, boiling point, and spectral data, would require empirical measurement or literature reference for detailed analysis. Overall, this compound represents a class of organic molecules with diverse potential applications in chemical synthesis and drug development.

Formula: C₁₈H₂₁NO₂

InChI: InChI=1S/C18H21NO2/c1-3-4-5-12-21-16-9-7-15(8-10-16)18(20)17-11-6-14(2)13-19-17/h6-11,13H,3-5,12H2,1-2H3

InChI key: InChIKey=CVSUNUOTJWFKCP-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(OCCCCC)C=C1)C2=CC=C(C)C=N2

Synonyms:

• Methanone, (5-methyl-2-pyridinyl)[4-(pentyloxy)phenyl]-
• (5-Methyl-2-pyridinyl)[4-(pentyloxy)phenyl]methanone

5-Methyl-2-(4-pentyloxybenzoyl)pyridine

CAS: 1187166-55-7

Formula: C₁₈H₂₁NO₂

Purity: 97.0%

Molecular weight: 283.371

Ref: 10-F202881