CymitQuimica logo

CAS 1187166-67-1

:

(3,5-Dichlorophenyl)(6-methoxy-2-pyridinyl)methanone

Description:
(3,5-Dichlorophenyl)(6-methoxy-2-pyridinyl)methanone is a chemical compound characterized by its complex structure, which includes a dichlorophenyl group and a methoxy-substituted pyridine moiety. The presence of chlorine atoms on the phenyl ring enhances its reactivity and may influence its biological activity. The methoxy group contributes to the compound's lipophilicity, potentially affecting its solubility and permeability in biological systems. This compound is likely to exhibit specific interactions with biological targets, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of compounds with antimicrobial or anticancer properties. Additionally, the presence of both aromatic and heterocyclic components may contribute to its stability and reactivity under various conditions. As with many synthetic organic compounds, understanding its properties, such as melting point, boiling point, and spectral characteristics, would be essential for practical applications and further research.
Formula:C13H9Cl2NO2
InChI:InChI=1S/C13H9Cl2NO2/c1-18-12-4-2-3-11(16-12)13(17)8-5-9(14)7-10(15)6-8/h2-7H,1H3
InChI key:InChIKey=LMQOVLSKXLKJJS-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(Cl)=CC(Cl)=C1)C=2N=C(OC)C=CC2
Synonyms:
  • Methanone, (3,5-dichlorophenyl)(6-methoxy-2-pyridinyl)-
  • (3,5-Dichlorophenyl)(6-methoxy-2-pyridinyl)methanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.