CAS 1187166-70-6
:(2,3-Difluorophenyl)-4-isoquinolinylmethanone
Description:
(2,3-Difluorophenyl)-4-isoquinolinylmethanone, identified by its CAS number 1187166-70-6, is a chemical compound characterized by its unique structural features, which include a difluorophenyl group and an isoquinoline moiety. This compound typically exhibits properties associated with aromatic systems, such as stability and potential for π-π stacking interactions. The presence of fluorine atoms can influence its reactivity and polarity, often enhancing lipophilicity and altering electronic properties. As a ketone, it contains a carbonyl group, which can participate in various chemical reactions, including nucleophilic additions. The isoquinoline structure may contribute to biological activity, making this compound of interest in medicinal chemistry and drug development. Its synthesis and characterization would involve standard organic chemistry techniques, and its potential applications could span pharmaceuticals, agrochemicals, or materials science, depending on its specific properties and reactivity. Further studies would be necessary to elucidate its full range of characteristics and potential uses.
Formula:C16H9F2NO
InChI:InChI=1S/C16H9F2NO/c17-14-7-3-6-12(15(14)18)16(20)13-9-19-8-10-4-1-2-5-11(10)13/h1-9H
InChI key:InChIKey=JODGXSJRXNNULN-UHFFFAOYSA-N
SMILES:C(=O)(C=1C2=C(C=NC1)C=CC=C2)C3=C(F)C(F)=CC=C3
Synonyms:- Methanone, (2,3-difluorophenyl)-4-isoquinolinyl-
- (2,3-Difluorophenyl)-4-isoquinolinylmethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.