CAS 1187166-74-0

(2,3-Dimethylphenyl)(4-methyl-3-pyridinyl)methanone

Description:

(2,3-Dimethylphenyl)(4-methyl-3-pyridinyl)methanone is an organic compound characterized by its complex structure, which includes a dimethyl-substituted phenyl group and a methyl-substituted pyridine moiety attached to a carbonyl group. This compound typically exhibits properties associated with ketones, such as a distinct carbonyl functional group that can participate in various chemical reactions, including nucleophilic addition and condensation. The presence of multiple methyl groups contributes to its hydrophobic character, potentially influencing its solubility in organic solvents. Additionally, the pyridine ring introduces basicity and potential for coordination with metal ions, which can be relevant in various chemical applications. The compound may also exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential for interactions in biological systems, and it may serve as a scaffold for further chemical modifications. Overall, (2,3-Dimethylphenyl)(4-methyl-3-pyridinyl)methanone is a versatile compound with applications in organic synthesis and medicinal chemistry.

Formula: C₁₅H₁₅NO

InChI: InChI=1S/C15H15NO/c1-10-5-4-6-13(12(10)3)15(17)14-9-16-8-7-11(14)2/h4-9H,1-3H3

InChI key: InChIKey=HEKPRYRMXRETQJ-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(C)C(C)=CC=C1)C=2C(C)=CC=NC2

Synonyms:

• (2,3-Dimethylphenyl)(4-methyl-3-pyridinyl)methanone
• Methanone, (2,3-dimethylphenyl)(4-methyl-3-pyridinyl)-