CAS 1187166-81-9: (2,6-Dichlorophenyl)-4-isoquinolinylmethanone

Description:(2,6-Dichlorophenyl)-4-isoquinolinylmethanone, identified by its CAS number 1187166-81-9, is a chemical compound that features a complex structure combining a dichlorophenyl group with an isoquinoline moiety. This compound typically exhibits characteristics common to aromatic compounds, such as stability and potential for engaging in electrophilic substitution reactions due to the presence of electron-withdrawing chlorine atoms. The dichlorophenyl group enhances its lipophilicity, which may influence its solubility in organic solvents. The isoquinoline structure contributes to its potential biological activity, as isoquinolines are known for their presence in various natural products and pharmaceuticals. The compound may also exhibit fluorescence properties, making it of interest in certain analytical applications. Its specific reactivity and interactions would depend on the functional groups present and the overall molecular conformation. As with many synthetic organic compounds, safety data and handling precautions should be considered, particularly regarding its potential toxicity and environmental impact.

Formula:C₁₆H₉Cl₂NO

InChI:InChI=1S/C16H9Cl2NO/c17-13-6-3-7-14(18)15(13)16(20)12-9-19-8-10-4-1-2-5-11(10)12/h1-9H

InChI key:InChIKey=WHIKMODSDFQNMC-UHFFFAOYSA-N

SMILES:O=C(C1=CN=CC2=CC=CC=C21)C=3C(Cl)=CC=CC3Cl

Synonyms:
(2,6-Dichlorophenyl)-4-isoquinolinylmethanone
Methanone, (2,6-dichlorophenyl)-4-isoquinolinyl-

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	4-(2,6-Dichlorobenzoyl)isoquinoline REF: 10-F203234CAS: 1187166-81-9	97.0%	- - -	Discontinued product
	4-(2,6-Dichlorobenzoyl)isoquinoline REF: 3D-MXB16681CAS: 1187166-81-9	Min. 95%	- - -	Discontinued product