CAS 1187166-83-1

3-Quinolinyl[3-(trifluoromethyl)phenyl]methanone

Description:

3-Quinolinyl[3-(trifluoromethyl)phenyl]methanone, identified by its CAS number 1187166-83-1, is a chemical compound characterized by its unique structural features, which include a quinoline moiety and a trifluoromethyl-substituted phenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential applications in pharmaceuticals and agrochemicals. The presence of the trifluoromethyl group enhances lipophilicity and metabolic stability, making it an interesting candidate for drug development. Additionally, the quinoline structure is known for its biological activity, including antimicrobial and antitumor properties. The compound may also display significant UV absorbance due to its conjugated system, which can be relevant in photochemical applications. Overall, 3-Quinolinyl[3-(trifluoromethyl)phenyl]methanone represents a versatile scaffold in medicinal chemistry, with potential implications in various fields, including material science and organic synthesis.

Formula: C₁₇H₁₀F₃NO

InChI: InChI=1S/C17H10F3NO/c18-17(19,20)14-6-3-5-12(9-14)16(22)13-8-11-4-1-2-7-15(11)21-10-13/h1-10H

InChI key: InChIKey=DEYXFNKCNKQUFW-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC2=C(N=C1)C=CC=C2)C3=CC(C(F)(F)F)=CC=C3

Synonyms:

• 3-Quinolinyl[3-(trifluoromethyl)phenyl]methanone
• Methanone, 3-quinolinyl[3-(trifluoromethyl)phenyl]-

3-(3-Trifluoromethylbenzoyl)quinoline

CAS: 1187166-83-1

Formula: C₁₇H₁₀F₃NO

Purity: 97.0%

Molecular weight: 301.268

Ref: 10-F203259