CAS 1187166-86-4
:(4-Chlorophenyl)-4-isoquinolinylmethanone
Description:
(4-Chlorophenyl)-4-isoquinolinylmethanone, identified by its CAS number 1187166-86-4, is a chemical compound that features a chlorinated phenyl group and an isoquinoline moiety. This compound typically exhibits characteristics common to aromatic compounds, such as stability and a tendency to engage in electrophilic substitution reactions. The presence of the chlorophenyl group can enhance lipophilicity and influence the compound's biological activity, potentially making it a candidate for pharmaceutical applications. The isoquinoline structure contributes to its aromaticity and may also affect its interaction with biological targets. In terms of solubility, compounds of this nature may show varying degrees of solubility in organic solvents, while their reactivity can be influenced by the functional groups present. Overall, (4-Chlorophenyl)-4-isoquinolinylmethanone is of interest in medicinal chemistry, particularly for its potential therapeutic properties, although specific biological activities would require further investigation through experimental studies.
Formula:C16H10ClNO
InChI:InChI=1S/C16H10ClNO/c17-13-7-5-11(6-8-13)16(19)15-10-18-9-12-3-1-2-4-14(12)15/h1-10H
InChI key:InChIKey=ZSQJJUYXCGWILU-UHFFFAOYSA-N
SMILES:C(=O)(C=1C2=C(C=NC1)C=CC=C2)C3=CC=C(Cl)C=C3
Synonyms:- (4-Chlorophenyl)-4-isoquinolinylmethanone
- Methanone, (4-chlorophenyl)-4-isoquinolinyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.