CAS 1187166-93-3
:(6-Methyl-3-pyridinyl)[3-(trifluoromethyl)phenyl]methanone
Description:
(6-Methyl-3-pyridinyl)[3-(trifluoromethyl)phenyl]methanone, identified by its CAS number 1187166-93-3, is an organic compound characterized by its complex structure, which includes a pyridine ring and a trifluoromethyl-substituted phenyl group. The presence of the methyl group on the pyridine ring contributes to its lipophilicity, potentially influencing its solubility and biological activity. The trifluoromethyl group is known for enhancing the metabolic stability and bioactivity of compounds, often increasing their potency in pharmaceutical applications. This compound may exhibit interesting properties such as potential antimicrobial or anticancer activities, although specific biological data would be necessary to confirm such effects. Its molecular structure suggests it could participate in various chemical reactions typical of ketones and aromatic compounds, making it a candidate for further research in medicinal chemistry and material science. Safety and handling precautions should be observed, as with any chemical substance, particularly those with halogenated groups.
Formula:C14H10F3NO
InChI:InChI=1S/C14H10F3NO/c1-9-5-6-11(8-18-9)13(19)10-3-2-4-12(7-10)14(15,16)17/h2-8H,1H3
InChI key:InChIKey=HWDDLWREUHHCJJ-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(C(F)(F)F)=CC=C1)C=2C=CC(C)=NC2
Synonyms:- (6-Methyl-3-pyridinyl)[3-(trifluoromethyl)phenyl]methanone
- Methanone, (6-methyl-3-pyridinyl)[3-(trifluoromethyl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.