CAS 1187166-97-7

(4-Methoxyphenyl)(6-methoxy-2-pyridinyl)methanone

Description:

(4-Methoxyphenyl)(6-methoxy-2-pyridinyl)methanone, identified by its CAS number 1187166-97-7, is an organic compound characterized by its complex structure, which includes a methanone functional group attached to both a methoxy-substituted phenyl group and a methoxy-substituted pyridine ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential for various chemical reactions. The presence of methoxy groups enhances its solubility in organic solvents and may influence its reactivity and interaction with biological systems. Additionally, the pyridine moiety can impart unique electronic properties, making it of interest in medicinal chemistry and material science. The compound's specific characteristics, such as melting point, boiling point, and spectral data, would be determined through experimental methods, providing insights into its behavior in different environments. Overall, this compound's structural features suggest potential applications in pharmaceuticals or as a building block in organic synthesis.

Formula: C₁₄H₁₃NO₃

InChI: InChI=1S/C14H13NO3/c1-17-11-8-6-10(7-9-11)14(16)12-4-3-5-13(15-12)18-2/h3-9H,1-2H3

InChI key: InChIKey=KIAQSIHZBMCQPF-UHFFFAOYSA-N

SMILES: C(=O)(C=1N=C(OC)C=CC1)C2=CC=C(OC)C=C2

Synonyms:

• Methanone, (4-methoxyphenyl)(6-methoxy-2-pyridinyl)-
• (4-Methoxyphenyl)(6-methoxy-2-pyridinyl)methanone