CymitQuimica logo

CAS 1187167-03-8

:

(6-Methoxy-2-pyridinyl)[3-(trifluoromethyl)phenyl]methanone

Description:
The chemical substance known as (6-Methoxy-2-pyridinyl)[3-(trifluoromethyl)phenyl]methanone, with the CAS number 1187167-03-8, is characterized by its complex molecular structure, which includes a pyridine ring substituted with a methoxy group and a phenyl ring that features a trifluoromethyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of electron-withdrawing groups like trifluoromethyl. The methoxy group can influence the compound's solubility and polarity, while the trifluoromethyl group may enhance lipophilicity and biological activity. Such compounds are often of interest in medicinal chemistry and material science due to their potential applications in drug development and as intermediates in organic synthesis. Additionally, the presence of fluorine atoms can impart unique electronic properties, making this compound a candidate for further research in various chemical and pharmaceutical contexts.
Formula:C14H10F3NO2
InChI:InChI=1S/C14H10F3NO2/c1-20-12-7-3-6-11(18-12)13(19)9-4-2-5-10(8-9)14(15,16)17/h2-8H,1H3
InChI key:InChIKey=SKFBCBAHGPKTGY-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(C(F)(F)F)=CC=C1)C=2N=C(OC)C=CC2
Synonyms:
  • (6-Methoxy-2-pyridinyl)[3-(trifluoromethyl)phenyl]methanone
  • Methanone, (6-methoxy-2-pyridinyl)[3-(trifluoromethyl)phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.