CAS 1187167-04-9
:(2,3-Dimethylphenyl)(6-methyl-3-pyridinyl)methanone
Description:
(2,3-Dimethylphenyl)(6-methyl-3-pyridinyl)methanone, identified by its CAS number 1187167-04-9, is an organic compound characterized by its complex structure, which includes a phenyl group substituted with two methyl groups and a pyridine ring with a methyl substituent. This compound features a ketone functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of both aromatic and heteroaromatic systems in its structure suggests that it may exhibit interesting electronic properties and could participate in various chemical reactions, such as electrophilic aromatic substitution or nucleophilic addition. Additionally, the specific arrangement of substituents may influence its solubility, boiling point, and stability, making it relevant in fields such as medicinal chemistry and materials science. Its unique characteristics may also lead to potential biological activity, warranting further investigation into its pharmacological properties. Overall, this compound exemplifies the diversity of organic molecules and their potential applications in various scientific domains.
Formula:C15H15NO
InChI:InChI=1S/C15H15NO/c1-10-5-4-6-14(12(10)3)15(17)13-8-7-11(2)16-9-13/h4-9H,1-3H3
InChI key:InChIKey=STHHIUXSIZQJKA-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(C)C(C)=CC=C1)C=2C=CC(C)=NC2
Synonyms:- Methanone, (2,3-dimethylphenyl)(6-methyl-3-pyridinyl)-
- (2,3-Dimethylphenyl)(6-methyl-3-pyridinyl)methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.