CAS 1187167-05-0

(3,5-Difluorophenyl)(4-methyl-2-pyridinyl)methanone

Description:

(3,5-Difluorophenyl)(4-methyl-2-pyridinyl)methanone is an organic compound characterized by its complex structure, which includes a phenyl ring substituted with two fluorine atoms at the 3 and 5 positions, and a pyridine ring with a methyl group at the 4 position. This compound features a ketone functional group, which contributes to its reactivity and potential applications in various chemical reactions. The presence of fluorine atoms typically enhances the compound's lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The pyridine moiety can participate in coordination with metal ions, and the overall structure may exhibit interesting electronic properties due to the conjugation between the aromatic systems. This compound may be utilized in the development of pharmaceuticals or agrochemicals, given its unique structural features. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be subject to further studies to explore its potential applications and interactions in biological systems.

Formula: C₁₃H₉F₂NO

InChI: InChI=1S/C13H9F2NO/c1-8-2-3-16-12(4-8)13(17)9-5-10(14)7-11(15)6-9/h2-7H,1H3

InChI key: InChIKey=HGALWUGXGDLXSU-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(F)=CC(F)=C1)C2=CC(C)=CC=N2

Synonyms:

• Methanone, (3,5-difluorophenyl)(4-methyl-2-pyridinyl)-
• (3,5-Difluorophenyl)(4-methyl-2-pyridinyl)methanone