CymitQuimica logo

CAS 1187167-15-2

:

(4-Ethoxyphenyl)(3-methyl-2-pyridinyl)methanone

Description:
(4-Ethoxyphenyl)(3-methyl-2-pyridinyl)methanone, identified by its CAS number 1187167-15-2, is an organic compound characterized by its complex structure, which includes an ethoxy group attached to a phenyl ring and a pyridine moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of functional groups. The ethoxy group contributes to its solubility in organic solvents, while the pyridine ring may impart basicity and influence its interaction with other chemical species. The compound may be of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activity and utility in synthesizing other chemical entities. Its specific applications and behavior in reactions would depend on the context of use, including the presence of other reactants and the conditions under which it is studied. Overall, this compound exemplifies the diversity of organic chemistry and the significance of functional group interactions in determining chemical properties.
Formula:C15H15NO2
InChI:InChI=1S/C15H15NO2/c1-3-18-13-8-6-12(7-9-13)15(17)14-11(2)5-4-10-16-14/h4-10H,3H2,1-2H3
InChI key:InChIKey=JLDPMBPAZWELTR-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC=C(OCC)C=C1)C2=C(C)C=CC=N2
Synonyms:
  • (4-Ethoxyphenyl)(3-methyl-2-pyridinyl)methanone
  • Methanone, (4-ethoxyphenyl)(3-methyl-2-pyridinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.