CAS 1187167-21-0

(3-Methyl-2-pyridinyl)[4-(pentyloxy)phenyl]methanone

Description:

(3-Methyl-2-pyridinyl)[4-(pentyloxy)phenyl]methanone, identified by its CAS number 1187167-21-0, is an organic compound characterized by its complex structure that includes a pyridine ring and a phenyl group substituted with a pentyloxy chain. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential for various chemical reactions. The presence of the methanone functional group suggests it may participate in reactions typical of ketones, including nucleophilic addition. The pentyloxy substituent can influence the compound's solubility and polarity, potentially enhancing its lipophilicity. Such characteristics may make it of interest in pharmaceutical applications or as a building block in organic synthesis. Additionally, the methyl group on the pyridine ring can affect the electronic properties of the molecule, potentially influencing its reactivity and interaction with biological targets. Overall, this compound's unique structural features contribute to its potential utility in various chemical and medicinal contexts.

Formula: C₁₈H₂₁NO₂

InChI: InChI=1S/C18H21NO2/c1-3-4-5-13-21-16-10-8-15(9-11-16)18(20)17-14(2)7-6-12-19-17/h6-12H,3-5,13H2,1-2H3

InChI key: InChIKey=SUGQEQGDFGBADJ-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(C)C=CC=N1)C2=CC=C(OCCCCC)C=C2

Synonyms:

• Methanone, (3-methyl-2-pyridinyl)[4-(pentyloxy)phenyl]-
• (3-Methyl-2-pyridinyl)[4-(pentyloxy)phenyl]methanone

3-Methyl-2-(4-pentyloxybenzoyl)pyridine

CAS: 1187167-21-0

Formula: C₁₈H₂₁NO₂

Purity: 97.0%

Molecular weight: 283.371

Ref: 10-F203017