CAS 1187167-22-1

(3-Fluorophenyl)(2-methyl-4-pyridinyl)methanone

Description:

(3-Fluorophenyl)(2-methyl-4-pyridinyl)methanone, identified by its CAS number 1187167-22-1, is an organic compound characterized by its unique structural features. It consists of a phenyl ring substituted with a fluorine atom at the meta position and a pyridine ring that is further substituted with a methyl group. The presence of the ketone functional group (methanone) indicates that it has a carbonyl (C=O) moiety, which contributes to its reactivity and potential applications in various chemical reactions. This compound may exhibit interesting biological activities due to its structural components, making it a candidate for pharmaceutical research. Its solubility, stability, and reactivity can vary based on the solvent and environmental conditions. Additionally, the presence of both aromatic and heterocyclic rings suggests potential interactions with biological targets, which could be explored in medicinal chemistry. Overall, (3-Fluorophenyl)(2-methyl-4-pyridinyl)methanone represents a versatile structure in organic synthesis and drug development.

Formula: C₁₃H₁₀FNO

InChI: InChI=1S/C13H10FNO/c1-9-7-11(5-6-15-9)13(16)10-3-2-4-12(14)8-10/h2-8H,1H3

InChI key: InChIKey=SCJLEGFVIRTXOZ-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(F)=CC=C1)C=2C=C(C)N=CC2

Synonyms:

• Methanone, (3-fluorophenyl)(2-methyl-4-pyridinyl)-
• (3-Fluorophenyl)(2-methyl-4-pyridinyl)methanone