CAS 1187167-45-8

(3-Iodophenyl)-3-pyridinylmethanone

Description:

(3-Iodophenyl)-3-pyridinylmethanone, identified by its CAS number 1187167-45-8, is a chemical compound that features a pyridine ring and an iodo-substituted phenyl group. This compound typically exhibits characteristics common to aromatic ketones, including a relatively high melting point and stability under standard conditions. The presence of the iodine atom contributes to its reactivity, particularly in nucleophilic substitution reactions, while the ketone functional group can participate in various chemical transformations, such as oxidation and reduction. The compound may also exhibit interesting biological activities, making it of interest in medicinal chemistry. Its solubility can vary depending on the solvent, often being more soluble in organic solvents than in water. Additionally, the molecular structure suggests potential for interactions with biological targets, which could be explored in drug development. Overall, (3-Iodophenyl)-3-pyridinylmethanone is a versatile compound with applications in organic synthesis and potentially in pharmaceutical research.

Formula: C₁₂H₈INO

InChI: InChI=1S/C12H8INO/c13-11-5-1-3-9(7-11)12(15)10-4-2-6-14-8-10/h1-8H

InChI key: InChIKey=OMCROJPACYIJAS-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(I)=CC=C1)C=2C=CC=NC2

Synonyms:

• (3-Iodophenyl)-3-pyridinylmethanone
• Methanone, (3-iodophenyl)-3-pyridinyl-