CAS 1187167-50-5

(3,4-Difluorophenyl)(2-methyl-4-pyridinyl)methanone

Description:

(3,4-Difluorophenyl)(2-methyl-4-pyridinyl)methanone, identified by its CAS number 1187167-50-5, is an organic compound characterized by its complex structure, which includes a difluorophenyl group and a pyridinyl moiety. This compound typically exhibits properties associated with aromatic systems, such as stability and potential for engaging in electrophilic substitution reactions. The presence of fluorine atoms enhances its lipophilicity and may influence its reactivity and biological activity. The pyridine ring contributes to the compound's basicity and can participate in coordination with metal ions. Additionally, the methanone functional group indicates the presence of a carbonyl, which can engage in hydrogen bonding and affect the compound's solubility in various solvents. Overall, this compound may have applications in medicinal chemistry or material science, depending on its specific interactions and properties, which are influenced by the arrangement of its functional groups and substituents.

Formula: C₁₃H₉F₂NO

InChI: InChI=1S/C13H9F2NO/c1-8-6-10(4-5-16-8)13(17)9-2-3-11(14)12(15)7-9/h2-7H,1H3

InChI key: InChIKey=CMSRNGHQVCPTRK-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(F)=C(F)C=C1)C=2C=C(C)N=CC2

Synonyms:

• (3,4-Difluorophenyl)(2-methyl-4-pyridinyl)methanone
• Methanone, (3,4-difluorophenyl)(2-methyl-4-pyridinyl)-