CAS 1187167-51-6

(2,3-Dimethylphenyl)-3-pyridinylmethanone

Description:

(2,3-Dimethylphenyl)-3-pyridinylmethanone, identified by its CAS number 1187167-51-6, is an organic compound characterized by its complex structure that includes a dimethyl-substituted phenyl group and a pyridinylmethanone moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the carbonyl group. Its molecular structure suggests it may participate in various chemical reactions, including electrophilic aromatic substitution and nucleophilic attacks, owing to the electron-rich nature of the dimethylphenyl group and the electron-deficient pyridine ring. The compound may also display interesting biological activities, making it a candidate for pharmaceutical research. Additionally, its solubility and melting point characteristics would depend on the specific functional groups and their interactions with solvents. Overall, (2,3-Dimethylphenyl)-3-pyridinylmethanone represents a versatile structure with potential applications in organic synthesis and medicinal chemistry.

Formula: C₁₄H₁₃NO

InChI: InChI=1S/C14H13NO/c1-10-5-3-7-13(11(10)2)14(16)12-6-4-8-15-9-12/h3-9H,1-2H3

InChI key: InChIKey=PHBLYBZTDZAZLK-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(C)C(C)=CC=C1)C=2C=CC=NC2

Synonyms:

• (2,3-Dimethylphenyl)-3-pyridinylmethanone
• Methanone, (2,3-dimethylphenyl)-3-pyridinyl-