CAS 1187167-55-0
:(6-Methoxy-2-pyridinyl)(2-methylphenyl)methanone
Description:
(6-Methoxy-2-pyridinyl)(2-methylphenyl)methanone, identified by its CAS number 1187167-55-0, is an organic compound characterized by its unique structural features. It contains a pyridine ring substituted at the 6-position with a methoxy group, which enhances its solubility and reactivity. The compound also features a ketone functional group, which is indicative of its potential reactivity in various chemical reactions, such as nucleophilic additions. The presence of the 2-methylphenyl group contributes to its hydrophobic characteristics and may influence its biological activity. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, which could be explored in drug development. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and industrial applications. Overall, (6-Methoxy-2-pyridinyl)(2-methylphenyl)methanone represents a versatile chemical entity with potential applications in various fields.
Formula:C14H13NO2
InChI:InChI=1S/C14H13NO2/c1-10-6-3-4-7-11(10)14(16)12-8-5-9-13(15-12)17-2/h3-9H,1-2H3
InChI key:InChIKey=BLWZNFYQCUVTIF-UHFFFAOYSA-N
SMILES:C(=O)(C=1N=C(OC)C=CC1)C2=C(C)C=CC=C2
Synonyms:- Methanone, (6-methoxy-2-pyridinyl)(2-methylphenyl)-
- (6-Methoxy-2-pyridinyl)(2-methylphenyl)methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.