CAS 1187167-60-7

(6-Methoxy-2-pyridinyl)(4-methylphenyl)methanone

Description:

(6-Methoxy-2-pyridinyl)(4-methylphenyl)methanone, with the CAS number 1187167-60-7, is an organic compound characterized by its unique structural features. It contains a pyridine ring substituted at the 6-position with a methoxy group and a ketone functional group attached to a 4-methylphenyl moiety. This compound is likely to exhibit properties typical of both aromatic and heterocyclic compounds, including potential biological activity due to the presence of the pyridine ring, which is known for its role in various pharmacological applications. The methoxy group can influence the compound's solubility and reactivity, while the ketone functionality may participate in various chemical reactions, such as nucleophilic additions. The presence of the methyl group on the phenyl ring can also affect the compound's steric and electronic properties. Overall, this compound may be of interest in medicinal chemistry and material science, although specific applications would depend on further research into its biological activity and chemical behavior.

Formula: C₁₄H₁₃NO₂

InChI: InChI=1S/C14H13NO2/c1-10-6-8-11(9-7-10)14(16)12-4-3-5-13(15-12)17-2/h3-9H,1-2H3

InChI key: InChIKey=DKNSFOAJMJPFHM-UHFFFAOYSA-N

SMILES: C(=O)(C=1N=C(OC)C=CC1)C2=CC=C(C)C=C2

Synonyms:

• Methanone, (6-methoxy-2-pyridinyl)(4-methylphenyl)-
• (6-Methoxy-2-pyridinyl)(4-methylphenyl)methanone