CymitQuimica logo

CAS 1187167-66-3

:

(2,3-Dimethylphenyl)(2-methyl-4-pyridinyl)methanone

Description:
(2,3-Dimethylphenyl)(2-methyl-4-pyridinyl)methanone, identified by its CAS number 1187167-66-3, is an organic compound characterized by its complex structure, which includes a phenyl group substituted with two methyl groups and a pyridine ring with a methyl substituent. This compound typically exhibits properties associated with ketones, such as a carbonyl functional group that contributes to its reactivity and potential applications in organic synthesis. The presence of both aromatic and heterocyclic components suggests that it may possess interesting electronic properties and could participate in various chemical reactions, including nucleophilic additions or substitutions. Additionally, the compound's molecular structure may influence its solubility, boiling point, and stability under different conditions. While specific physical and chemical properties such as melting point, boiling point, and solubility are not provided, compounds of this nature are often studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis.
Formula:C15H15NO
InChI:InChI=1S/C15H15NO/c1-10-5-4-6-14(12(10)3)15(17)13-7-8-16-11(2)9-13/h4-9H,1-3H3
InChI key:InChIKey=DJGFHHGWDTVMGU-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(C)C(C)=CC=C1)C=2C=C(C)N=CC2
Synonyms:
  • Methanone, (2,3-dimethylphenyl)(2-methyl-4-pyridinyl)-
  • (2,3-Dimethylphenyl)(2-methyl-4-pyridinyl)methanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.