CAS 1187167-68-5
:(4-Butoxyphenyl)(6-methyl-3-pyridinyl)methanone
Description:
(4-Butoxyphenyl)(6-methyl-3-pyridinyl)methanone, identified by its CAS number 1187167-68-5, is an organic compound characterized by its complex structure, which includes a butoxy group attached to a phenyl ring and a pyridinyl moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of functional groups. The butoxy group contributes to its solubility in organic solvents, while the pyridinyl component may impart basicity and influence its interaction with biological systems. The presence of a ketone functional group suggests potential reactivity in nucleophilic addition reactions. This compound may be of interest in medicinal chemistry and material science due to its structural features, which could lead to specific biological activities or applications in synthesis. Overall, its characteristics make it a subject of interest for further research in various chemical and pharmaceutical contexts.
Formula:C17H19NO2
InChI:InChI=1S/C17H19NO2/c1-3-4-11-20-16-9-7-14(8-10-16)17(19)15-6-5-13(2)18-12-15/h5-10,12H,3-4,11H2,1-2H3
InChI key:InChIKey=MHPQCUORULUBBI-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC=C(OCCCC)C=C1)C=2C=CC(C)=NC2
Synonyms:- Methanone, (4-butoxyphenyl)(6-methyl-3-pyridinyl)-
- (4-Butoxyphenyl)(6-methyl-3-pyridinyl)methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.