CAS 1187167-75-4

(2-Methoxyphenyl)(4-methyl-3-pyridinyl)methanone

Description:

(2-Methoxyphenyl)(4-methyl-3-pyridinyl)methanone, identified by its CAS number 1187167-75-4, is an organic compound characterized by its complex structure, which includes a methoxy group attached to a phenyl ring and a pyridine moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of functional groups. The methoxy group can influence its solubility and polarity, while the pyridine ring may contribute to its basicity and potential interactions in biological systems. The compound may be of interest in medicinal chemistry, particularly for its potential pharmacological activities, as derivatives of similar structures have been explored for various therapeutic applications. Its synthesis and characterization would involve standard organic chemistry techniques, including spectroscopic methods for confirmation of structure. Overall, this compound represents a class of molecules that may have significant implications in drug development and chemical research.

Formula: C₁₄H₁₃NO₂

InChI: InChI=1S/C14H13NO2/c1-10-7-8-15-9-12(10)14(16)11-5-3-4-6-13(11)17-2/h3-9H,1-2H3

InChI key: InChIKey=FWKJBWUDWYYAQC-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(OC)C=CC=C1)C=2C(C)=CC=NC2

Synonyms:

• Methanone, (2-methoxyphenyl)(4-methyl-3-pyridinyl)-
• (2-Methoxyphenyl)(4-methyl-3-pyridinyl)methanone