CAS 1187167-79-8
:(2,6-Dimethylphenyl)(4-methyl-3-pyridinyl)methanone
Description:
(2,6-Dimethylphenyl)(4-methyl-3-pyridinyl)methanone, identified by its CAS number 1187167-79-8, is an organic compound characterized by its complex structure, which includes a dimethyl-substituted phenyl group and a pyridine moiety. This compound typically exhibits properties associated with aromatic compounds, such as stability and a tendency to participate in electrophilic substitution reactions. The presence of both the phenyl and pyridine rings suggests potential for diverse chemical reactivity, including interactions with nucleophiles and electrophiles. Additionally, the methyl groups contribute to the compound's hydrophobic character, influencing its solubility in organic solvents. The compound may also exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure allows for potential applications in various fields, including materials science and medicinal chemistry. Overall, (2,6-Dimethylphenyl)(4-methyl-3-pyridinyl)methanone is a versatile compound with properties that warrant further investigation for its potential uses.
Formula:C15H15NO
InChI:InChI=1S/C15H15NO/c1-10-7-8-16-9-13(10)15(17)14-11(2)5-4-6-12(14)3/h4-9H,1-3H3
InChI key:InChIKey=ACNNFAZOUXUWDO-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(C)C=CC=C1C)C=2C(C)=CC=NC2
Synonyms:- (2,6-Dimethylphenyl)(4-methyl-3-pyridinyl)methanone
- Methanone, (2,6-dimethylphenyl)(4-methyl-3-pyridinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.